Main centres: | 1-3 business days |
Regional areas: | 3-4 business days |
Remote areas: | 3-5 business days |
(1,2-Cyclohexylenedinitrilo)tetraacetic acid (CDTA) is a chelating agent used in laboratories for various applications, including analytical chemistry and as a decomplexing agent in ion-selective electrode (ISE) measurements.
1.2-cyclohexylenedinitrilo-tetraacetic acid
Here's a more detailed look at its lab uses:
Chelating Agent:
CDTA, like EDTA, is a chelating agent, meaning it can bind to metal ions, forming complexes.
Analytical Chemistry:
It's used in analytical chemistry for the determination of metal ions, helping to prevent interference from other ions in the sample.
Decomplexing Agent in ISE Measurements:
In ion-selective electrode (ISE) measurements, particularly for fluoride determination, CDTA acts as a decomplexing agent, preventing the formation of interfering complexes with the analyte.
TISAB Solution:
CDTA is often a component of the Total Ionic Strength Adjustment Buffer (TISAB) solution, which is used to maintain a constant ionic strength during ISE measurements.
Other applications:
CDTA is also used in cosmetics, and has applications in water softening and food preservation.
trans-1,2-Diaminocyclohexane-N,N,N,N-tetraacetic acid monohydrate is a multidentate ligand{1-6} that may be used as a chelating agent in the preparation of metal-chelate complexes.
Grade | ACS reagent |
for complexometry | |
InChI Key | VASZYFIKPKYGNC-DHTOPLTISA-N |
assay | 97.5-100.5% |
98% | |
ign. residue | 0.2% |
mp | 213-216 °C (lit.) |
cation traces | Fe: 0.005% |
heavy metals (as Pb): 0.001% | |
SMILES string | [H]O[H].OC(=O)CN(CC(O)=O)[C@@H]1CCCC[C@H]1N(CC(O)=O)CC(O)=O |
1.2-cyclohexylenedinitrilo-tetraacetic acid